C12H30ClO6Si6 — CID 6330011
1,3,5,7,9,11-Hexaethyl-1-chlorocyclohexasiloxane (PubChem CID 6330011) has the molecular formula C12H30ClO6Si6 and a molecular weight of 474.34 g/mol.
| Compound Name | 1,3,5,7,9,11-Hexaethyl-1-chlorocyclohexasiloxane |
|---|---|
| PubChem CID | 6330011 |
| Molecular Formula | C12H30ClO6Si6 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | — |
| SMILES | CC[Si]1O[Si](CC)O[Si](CC)O[Si](Cl)(CC)O[Si](CC)O[Si](CC)O1 |
| InChI | InChI=1S/C12H30ClO6Si6/c1-7-20-14-21(8-2)16-23(10-4)18-25(13,12-6)19-24(11-5)17-22(9-3)15-20/h7-12H2,1-6H3 |
| InChIKey | LBDINMLCLPDPQP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|