C15H23BrN2O2 — CID 63300212
N-[(4-bromo-2,5-dimethoxyphenyl)methyl]-N-ethylpyrrolidin-3-amine (PubChem CID 63300212) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.27 g/mol. Its IUPAC name is N-[(4-bromo-2,5-dimethoxyphenyl)methyl]-N-ethylpyrrolidin-3-amine.
| Compound Name | N-[(4-bromo-2,5-dimethoxyphenyl)methyl]-N-ethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 63300212 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-[(4-bromo-2,5-dimethoxyphenyl)methyl]-N-ethylpyrrolidin-3-amine |
| SMILES | CCN(Cc1cc(OC)c(Br)cc1OC)C1CCNC1 |
| InChI | InChI=1S/C15H23BrN2O2/c1-4-18(12-5-6-17-9-12)10-11-7-15(20-3)13(16)8-14(11)19-2/h7-8,12,17H,4-6,9-10H2,1-3H3 |
| InChIKey | QAKBILXPRLPJLL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |