C13H17Cl3N2O2S — CID 63300848
2,4,6-trichloro-N-propyl-N-pyrrolidin-3-ylbenzenesulfonamide (PubChem CID 63300848) has the molecular formula C13H17Cl3N2O2S and a molecular weight of 371.72 g/mol. Its IUPAC name is 2,4,6-trichloro-N-propyl-N-pyrrolidin-3-ylbenzenesulfonamide.
| Compound Name | 2,4,6-trichloro-N-propyl-N-pyrrolidin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 63300848 |
| Molecular Formula | C13H17Cl3N2O2S |
| Molecular Weight | 371.72 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 2,4,6-trichloro-N-propyl-N-pyrrolidin-3-ylbenzenesulfonamide |
| SMILES | CCCN(C1CCNC1)S(=O)(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl3N2O2S/c1-2-5-18(10-3-4-17-8-10)21(19,20)13-11(15)6-9(14)7-12(13)16/h6-7,10,17H,2-5,8H2,1H3 |
| InChIKey | VDGVRUBCFYEAAP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.72 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |