C9H18N4O2 — CID 63301604
N-carbamoyl-2-[methyl(pyrrolidin-3-yl)amino]propanamide (PubChem CID 63301604) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is N-carbamoyl-2-[methyl(pyrrolidin-3-yl)amino]propanamide.
| Compound Name | N-carbamoyl-2-[methyl(pyrrolidin-3-yl)amino]propanamide |
|---|---|
| PubChem CID | 63301604 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | N-carbamoyl-2-[methyl(pyrrolidin-3-yl)amino]propanamide |
| SMILES | CC(C(=O)NC(N)=O)N(C)C1CCNC1 |
| InChI | InChI=1S/C9H18N4O2/c1-6(8(14)12-9(10)15)13(2)7-3-4-11-5-7/h6-7,11H,3-5H2,1-2H3,(H3,10,12,14,15) |
| InChIKey | OJBNBDWTLVVCGP-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |