About Triethylamine borane
Triethylamine borane (PubChem CID 6330188) has the molecular formula C6H15BN
and a molecular weight of 112.00 g/mol.
Molecular Properties
| Compound Name | Triethylamine borane |
| PubChem CID | 6330188 |
| Molecular Formula | C6H15BN |
| Molecular Weight | 112.00 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | — |
| SMILES | CCN(CC)CC.[B] |
| InChI | InChI=1S/C6H15N.B/c1-4-7(5-2)6-3;/h4-6H2,1-3H3; |
| InChIKey | VEWFZHAHZPVQES-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.00 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Triethylamine borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Triethylamine borane?
The IUPAC name of Triethylamine borane (CID 6330188) is not available.
What is the SMILES notation for Triethylamine borane?
The canonical SMILES for Triethylamine borane is CCN(CC)CC.[B].
What is the InChIKey of Triethylamine borane?
The InChIKey is VEWFZHAHZPVQES-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.B/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;.
What are the key properties of Triethylamine borane?
Triethylamine borane has a molecular weight of 112.00 g/mol, XLogP of 0.97, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Triethylamine borane is sourced from PubChem (CID 6330188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).