C13H27N3O2 — CID 63302739
tert-butyl 3-[2-[ethyl(methyl)amino]ethylamino]azetidine-1-carboxylate (PubChem CID 63302739) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is tert-butyl 3-[2-[ethyl(methyl)amino]ethylamino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[ethyl(methyl)amino]ethylamino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 63302739 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | tert-butyl 3-[2-[ethyl(methyl)amino]ethylamino]azetidine-1-carboxylate |
| SMILES | CCN(C)CCNC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H27N3O2/c1-6-15(5)8-7-14-11-9-16(10-11)12(17)18-13(2,3)4/h11,14H,6-10H2,1-5H3 |
| InChIKey | ZUKOQISFZDXSQL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |