About 1H-Pyrimidine-2,4-diselone
1H-Pyrimidine-2,4-diselone (PubChem CID 6330300) has the molecular formula C4H2N2Se2
and a molecular weight of 235.99 g/mol.
Molecular Properties
| Compound Name | 1H-Pyrimidine-2,4-diselone |
| PubChem CID | 6330300 |
| Molecular Formula | C4H2N2Se2 |
| Molecular Weight | 235.99 g/mol |
| Exact Mass | 237.85 |
| IUPAC Name | — |
| SMILES | [Se]c1ccnc([Se])n1 |
| InChI | InChI=1S/C4H2N2Se2/c7-3-1-2-5-4(8)6-3/h1-2H |
| InChIKey | PNARTZUNXURWLX-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.99 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1H-Pyrimidine-2,4-diselone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-Pyrimidine-2,4-diselone?
The IUPAC name of 1H-Pyrimidine-2,4-diselone (CID 6330300) is not available.
What is the SMILES notation for 1H-Pyrimidine-2,4-diselone?
The canonical SMILES for 1H-Pyrimidine-2,4-diselone is [Se]c1ccnc([Se])n1.
What is the InChIKey of 1H-Pyrimidine-2,4-diselone?
The InChIKey is PNARTZUNXURWLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2N2Se2/c7-3-1-2-5-4(8)6-3/h1-2H.
What are the key properties of 1H-Pyrimidine-2,4-diselone?
1H-Pyrimidine-2,4-diselone has a molecular weight of 235.99 g/mol, XLogP of -1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-Pyrimidine-2,4-diselone is sourced from PubChem (CID 6330300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).