C18F15Si — CID 6330339
Tris(2,3,4,5,6-pentafluorophenyl)silicon (PubChem CID 6330339) has the molecular formula C18F15Si and a molecular weight of 529.25 g/mol.
| Compound Name | Tris(2,3,4,5,6-pentafluorophenyl)silicon |
|---|---|
| PubChem CID | 6330339 |
| Molecular Formula | C18F15Si |
| Molecular Weight | 529.25 g/mol |
| Exact Mass | 528.95 |
| IUPAC Name | — |
| SMILES | Fc1c(F)c(F)c([Si](c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C18F15Si/c19-1-4(22)10(28)16(11(29)5(1)23)34(17-12(30)6(24)2(20)7(25)13(17)31)18-14(32)8(26)3(21)9(27)15(18)33 |
| InChIKey | MEDZYNGMHOZGGT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|