C13H15N3O2 — CID 63303630
2-(piperidin-4-ylmethyl)pyrrolo[3,4-c]pyridine-1,3-dione (PubChem CID 63303630) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-(piperidin-4-ylmethyl)pyrrolo[3,4-c]pyridine-1,3-dione.
| Compound Name | 2-(piperidin-4-ylmethyl)pyrrolo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 63303630 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-(piperidin-4-ylmethyl)pyrrolo[3,4-c]pyridine-1,3-dione |
| SMILES | O=C1c2ccncc2C(=O)N1CC1CCNCC1 |
| InChI | InChI=1S/C13H15N3O2/c17-12-10-3-6-15-7-11(10)13(18)16(12)8-9-1-4-14-5-2-9/h3,6-7,9,14H,1-2,4-5,8H2 |
| InChIKey | YDVCWMOOZNVXAK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|