About 1-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)cycloheptane-1-carbonitrile
1-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)cycloheptane-1-carbonitrile (PubChem CID 63303747) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is 1-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)cycloheptane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)cycloheptane-1-carbonitrile |
| PubChem CID | 63303747 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)cycloheptane-1-carbonitrile |
| SMILES | N#CC1(N2C(=O)c3ccncc3C2=O)CCCCCC1 |
| InChI | InChI=1S/C15H15N3O2/c16-10-15(6-3-1-2-4-7-15)18-13(19)11-5-8-17-9-12(11)14(18)20/h5,8-9H,1-4,6-7H2 |
| InChIKey | SDKCWIVDBWGJLZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)cycloheptane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)cycloheptane-1-carbonitrile?
The IUPAC name of 1-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)cycloheptane-1-carbonitrile (CID 63303747) is 1-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)cycloheptane-1-carbonitrile.
What is the SMILES notation for 1-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)cycloheptane-1-carbonitrile?
The canonical SMILES for 1-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)cycloheptane-1-carbonitrile is N#CC1(N2C(=O)c3ccncc3C2=O)CCCCCC1.
What is the InChIKey of 1-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)cycloheptane-1-carbonitrile?
The InChIKey is SDKCWIVDBWGJLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2/c16-10-15(6-3-1-2-4-7-15)18-13(19)11-5-8-17-9-12(11)14(18)20/h5,8-9H,1-4,6-7H2.
What are the key properties of 1-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)cycloheptane-1-carbonitrile?
1-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)cycloheptane-1-carbonitrile has a molecular weight of 269.30 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)cycloheptane-1-carbonitrile is sourced from PubChem (CID 63303747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).