C14H22N4O3 — CID 63303976
2-cyclohexyl-2-[(2-methylpyrazol-3-yl)methylcarbamoylamino]acetic acid (PubChem CID 63303976) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-cyclohexyl-2-[(2-methylpyrazol-3-yl)methylcarbamoylamino]acetic acid.
| Compound Name | 2-cyclohexyl-2-[(2-methylpyrazol-3-yl)methylcarbamoylamino]acetic acid |
|---|---|
| PubChem CID | 63303976 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-cyclohexyl-2-[(2-methylpyrazol-3-yl)methylcarbamoylamino]acetic acid |
| SMILES | Cn1nccc1CNC(=O)NC(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C14H22N4O3/c1-18-11(7-8-16-18)9-15-14(21)17-12(13(19)20)10-5-3-2-4-6-10/h7-8,10,12H,2-6,9H2,1H3,(H,19,20)(H2,15,17,21) |
| InChIKey | BXYYPGJIMNNARO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |