About CID 6330480
CID 6330480 (PubChem CID 6330480) has the molecular formula CH4N3Se
and a molecular weight of 137.02 g/mol.
Molecular Properties
| Compound Name | CID 6330480 |
| PubChem CID | 6330480 |
| Molecular Formula | CH4N3Se |
| Molecular Weight | 137.02 g/mol |
| Exact Mass | 137.96 |
| IUPAC Name | — |
| SMILES | NN=C(N)[Se] |
| InChI | InChI=1S/CH4N3Se/c2-1(5)4-3/h3H2,(H2,2,4) |
| InChIKey | GCVPPZSLIPNFGU-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.02 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 6330480 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6330480?
The IUPAC name of CID 6330480 (CID 6330480) is not available.
What is the SMILES notation for CID 6330480?
The canonical SMILES for CID 6330480 is NN=C(N)[Se].
What is the InChIKey of CID 6330480?
The InChIKey is GCVPPZSLIPNFGU-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N3Se/c2-1(5)4-3/h3H2,(H2,2,4).
What are the key properties of CID 6330480?
CID 6330480 has a molecular weight of 137.02 g/mol, XLogP of -1.66, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6330480 is sourced from PubChem (CID 6330480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).