C21H14F6OP+ — CID 6330533
1,1-diphenyl-3,3-bis(trifluoromethyl)-2,1-benzoxaphosphol-1-ium (PubChem CID 6330533) has the molecular formula C21H14F6OP+ and a molecular weight of 427.30 g/mol. Its IUPAC name is 1,1-diphenyl-3,3-bis(trifluoromethyl)-2,1-benzoxaphosphol-1-ium.
| Compound Name | 1,1-diphenyl-3,3-bis(trifluoromethyl)-2,1-benzoxaphosphol-1-ium |
|---|---|
| PubChem CID | 6330533 |
| Molecular Formula | C21H14F6OP+ |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 1,1-diphenyl-3,3-bis(trifluoromethyl)-2,1-benzoxaphosphol-1-ium |
| SMILES | FC(F)(F)C1(C(F)(F)F)O[P+](c2ccccc2)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C21H14F6OP/c22-20(23,24)19(21(25,26)27)17-13-7-8-14-18(17)29(28-19,15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H/q+1 |
| InChIKey | MPQUIGMQHCPYBY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|