About Triphenylgermyl--water (1/1)
Triphenylgermyl--water (1/1) (PubChem CID 6330566) has the molecular formula C18H17GeO
and a molecular weight of 321.94 g/mol.
Molecular Properties
| Compound Name | Triphenylgermyl--water (1/1) |
| PubChem CID | 6330566 |
| Molecular Formula | C18H17GeO |
| Molecular Weight | 321.94 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | — |
| SMILES | O.c1ccc([Ge](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15Ge.H2O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;1H2 |
| InChIKey | AIRGWNCSDJWTBV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.94 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Triphenylgermyl--water (1/1) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Triphenylgermyl--water (1/1)?
The IUPAC name of Triphenylgermyl--water (1/1) (CID 6330566) is not available.
What is the SMILES notation for Triphenylgermyl--water (1/1)?
The canonical SMILES for Triphenylgermyl--water (1/1) is O.c1ccc([Ge](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of Triphenylgermyl--water (1/1)?
The InChIKey is AIRGWNCSDJWTBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15Ge.H2O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;1H2.
What are the key properties of Triphenylgermyl--water (1/1)?
Triphenylgermyl--water (1/1) has a molecular weight of 321.94 g/mol, XLogP of 1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Triphenylgermyl--water (1/1) is sourced from PubChem (CID 6330566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).