C16H18F2N2O — CID 63305824
1-[4-(difluoromethoxy)phenyl]-N-[(3-methyl-2-pyridinyl)methyl]ethanamine (PubChem CID 63305824) has the molecular formula C16H18F2N2O and a molecular weight of 292.33 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-N-[(3-methyl-2-pyridinyl)methyl]ethanamine.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-N-[(3-methyl-2-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 63305824 |
| Molecular Formula | C16H18F2N2O |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-N-[(3-methyl-2-pyridinyl)methyl]ethanamine |
| SMILES | Cc1cccnc1CNC(C)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H18F2N2O/c1-11-4-3-9-19-15(11)10-20-12(2)13-5-7-14(8-6-13)21-16(17)18/h3-9,12,16,20H,10H2,1-2H3 |
| InChIKey | CIKAZJUUFZOJAS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |