About CID 6330659
CID 6330659 (PubChem CID 6330659) has the molecular formula C6H8GeO7
and a molecular weight of 264.73 g/mol.
Molecular Properties
| Compound Name | CID 6330659 |
| PubChem CID | 6330659 |
| Molecular Formula | C6H8GeO7 |
| Molecular Weight | 264.73 g/mol |
| Exact Mass | 265.95 |
| IUPAC Name | — |
| SMILES | O=C1C(O)=C(O)OC1C(O)CO.O=[Ge] |
| InChI | InChI=1S/C6H8O6.GeO/c7-1-2(8)5-3(9)4(10)6(11)12-5;1-2/h2,5,7-8,10-11H,1H2; |
| InChIKey | WZOWTFVYPVPXJH-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.73 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 6330659 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6330659?
The IUPAC name of CID 6330659 (CID 6330659) is not available.
What is the SMILES notation for CID 6330659?
The canonical SMILES for CID 6330659 is O=C1C(O)=C(O)OC1C(O)CO.O=[Ge].
What is the InChIKey of CID 6330659?
The InChIKey is WZOWTFVYPVPXJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O6.GeO/c7-1-2(8)5-3(9)4(10)6(11)12-5;1-2/h2,5,7-8,10-11H,1H2;.
What are the key properties of CID 6330659?
CID 6330659 has a molecular weight of 264.73 g/mol, XLogP of -1.91, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6330659 is sourced from PubChem (CID 6330659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).