C15H16FN3O — CID 63306626
3-fluoro-4-[[(3-methyl-2-pyridinyl)methylamino]methyl]benzamide (PubChem CID 63306626) has the molecular formula C15H16FN3O and a molecular weight of 273.31 g/mol. Its IUPAC name is 3-fluoro-4-[[(3-methyl-2-pyridinyl)methylamino]methyl]benzamide.
| Compound Name | 3-fluoro-4-[[(3-methyl-2-pyridinyl)methylamino]methyl]benzamide |
|---|---|
| PubChem CID | 63306626 |
| Molecular Formula | C15H16FN3O |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 3-fluoro-4-[[(3-methyl-2-pyridinyl)methylamino]methyl]benzamide |
| SMILES | Cc1cccnc1CNCc1ccc(C(N)=O)cc1F |
| InChI | InChI=1S/C15H16FN3O/c1-10-3-2-6-19-14(10)9-18-8-12-5-4-11(15(17)20)7-13(12)16/h2-7,18H,8-9H2,1H3,(H2,17,20) |
| InChIKey | IVYIJKQNSJNBMO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |