C13H14FNO6 — CID 63307164
(2S)-2-[[2-(2-fluorophenoxy)acetyl]amino]-4-methoxy-4-oxobutanoic acid (PubChem CID 63307164) has the molecular formula C13H14FNO6 and a molecular weight of 299.25 g/mol. Its IUPAC name is (2S)-2-[[2-(2-fluorophenoxy)acetyl]amino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[[2-(2-fluorophenoxy)acetyl]amino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63307164 |
| Molecular Formula | C13H14FNO6 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (2S)-2-[[2-(2-fluorophenoxy)acetyl]amino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NC(=O)COc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C13H14FNO6/c1-20-12(17)6-9(13(18)19)15-11(16)7-21-10-5-3-2-4-8(10)14/h2-5,9H,6-7H2,1H3,(H,15,16)(H,18,19)/t9-/m0/s1 |
| InChIKey | RTYRXWJSUXOIQF-VIFPVBQESA-N |
| XLogP | 0.34 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |