C14H19Cl2NO — CID 63308078
4-chloro-N-[(3-chlorophenyl)methyl]-N-propan-2-ylbutanamide (PubChem CID 63308078) has the molecular formula C14H19Cl2NO and a molecular weight of 288.22 g/mol. Its IUPAC name is 4-chloro-N-[(3-chlorophenyl)methyl]-N-propan-2-ylbutanamide.
| Compound Name | 4-chloro-N-[(3-chlorophenyl)methyl]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 63308078 |
| Molecular Formula | C14H19Cl2NO |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 4-chloro-N-[(3-chlorophenyl)methyl]-N-propan-2-ylbutanamide |
| SMILES | CC(C)N(Cc1cccc(Cl)c1)C(=O)CCCCl |
| InChI | InChI=1S/C14H19Cl2NO/c1-11(2)17(14(18)7-4-8-15)10-12-5-3-6-13(16)9-12/h3,5-6,9,11H,4,7-8,10H2,1-2H3 |
| InChIKey | TZUXSLUWIWXCHT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|