About 4-chloro-N-(2,2-dimethylcyclopropyl)butanamide
4-chloro-N-(2,2-dimethylcyclopropyl)butanamide (PubChem CID 63308432) has the molecular formula C9H16ClNO
and a molecular weight of 189.69 g/mol. Its IUPAC name is 4-chloro-N-(2,2-dimethylcyclopropyl)butanamide.
Molecular Properties
| Compound Name | 4-chloro-N-(2,2-dimethylcyclopropyl)butanamide |
| PubChem CID | 63308432 |
| Molecular Formula | C9H16ClNO |
| Molecular Weight | 189.69 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 4-chloro-N-(2,2-dimethylcyclopropyl)butanamide |
| SMILES | CC1(C)CC1NC(=O)CCCCl |
| InChI | InChI=1S/C9H16ClNO/c1-9(2)6-7(9)11-8(12)4-3-5-10/h7H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | UEFJLQOCNPVJOG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.69 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-(2,2-dimethylcyclopropyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(2,2-dimethylcyclopropyl)butanamide?
The IUPAC name of 4-chloro-N-(2,2-dimethylcyclopropyl)butanamide (CID 63308432) is 4-chloro-N-(2,2-dimethylcyclopropyl)butanamide.
What is the SMILES notation for 4-chloro-N-(2,2-dimethylcyclopropyl)butanamide?
The canonical SMILES for 4-chloro-N-(2,2-dimethylcyclopropyl)butanamide is CC1(C)CC1NC(=O)CCCCl.
What is the InChIKey of 4-chloro-N-(2,2-dimethylcyclopropyl)butanamide?
The InChIKey is UEFJLQOCNPVJOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClNO/c1-9(2)6-7(9)11-8(12)4-3-5-10/h7H,3-6H2,1-2H3,(H,11,12).
What are the key properties of 4-chloro-N-(2,2-dimethylcyclopropyl)butanamide?
4-chloro-N-(2,2-dimethylcyclopropyl)butanamide has a molecular weight of 189.69 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(2,2-dimethylcyclopropyl)butanamide is sourced from PubChem (CID 63308432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).