C15H19N3O2 — CID 63308703
3-[4-(2-hydroxyethyl)-1,4-diazepane-1-carbonyl]benzonitrile (PubChem CID 63308703) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-[4-(2-hydroxyethyl)-1,4-diazepane-1-carbonyl]benzonitrile.
| Compound Name | 3-[4-(2-hydroxyethyl)-1,4-diazepane-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 63308703 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-[4-(2-hydroxyethyl)-1,4-diazepane-1-carbonyl]benzonitrile |
| SMILES | N#Cc1cccc(C(=O)N2CCCN(CCO)CC2)c1 |
| InChI | InChI=1S/C15H19N3O2/c16-12-13-3-1-4-14(11-13)15(20)18-6-2-5-17(7-8-18)9-10-19/h1,3-4,11,19H,2,5-10H2 |
| InChIKey | ARFLQGCLCGPWEZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |