C16H17ClN2OS — CID 63309430
4-chloro-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]butanamide (PubChem CID 63309430) has the molecular formula C16H17ClN2OS and a molecular weight of 320.85 g/mol. Its IUPAC name is 4-chloro-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]butanamide.
| Compound Name | 4-chloro-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]butanamide |
|---|---|
| PubChem CID | 63309430 |
| Molecular Formula | C16H17ClN2OS |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-chloro-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]butanamide |
| SMILES | O=C(CCCCl)Nc1ccc(SCc2cccnc2)cc1 |
| InChI | InChI=1S/C16H17ClN2OS/c17-9-1-4-16(20)19-14-5-7-15(8-6-14)21-12-13-3-2-10-18-11-13/h2-3,5-8,10-11H,1,4,9,12H2,(H,19,20) |
| InChIKey | RVCQCSMOMRGQKH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|