C12H24N4O — CID 63310320
1-[3-[ethyl(1-methoxypropan-2-yl)amino]propyl]pyrazol-3-amine (PubChem CID 63310320) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-[3-[ethyl(1-methoxypropan-2-yl)amino]propyl]pyrazol-3-amine.
| Compound Name | 1-[3-[ethyl(1-methoxypropan-2-yl)amino]propyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 63310320 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | 1-[3-[ethyl(1-methoxypropan-2-yl)amino]propyl]pyrazol-3-amine |
| SMILES | CCN(CCCn1ccc(N)n1)C(C)COC |
| InChI | InChI=1S/C12H24N4O/c1-4-15(11(2)10-17-3)7-5-8-16-9-6-12(13)14-16/h6,9,11H,4-5,7-8,10H2,1-3H3,(H2,13,14) |
| InChIKey | RCBCVRVIJZXOIT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |