About 1-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]pyrazol-3-amine
1-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]pyrazol-3-amine (PubChem CID 63310519) has the molecular formula C12H20F3N5
and a molecular weight of 291.32 g/mol. Its IUPAC name is 1-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]pyrazol-3-amine.
Molecular Properties
| Compound Name | 1-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]pyrazol-3-amine |
| PubChem CID | 63310519 |
| Molecular Formula | C12H20F3N5 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]pyrazol-3-amine |
| SMILES | Nc1ccn(CCCN2CCN(CC(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C12H20F3N5/c13-12(14,15)10-19-8-6-18(7-9-19)3-1-4-20-5-2-11(16)17-20/h2,5H,1,3-4,6-10H2,(H2,16,17) |
| InChIKey | DKVRVLDRCNGXCZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]pyrazol-3-amine?
The IUPAC name of 1-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]pyrazol-3-amine (CID 63310519) is 1-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]pyrazol-3-amine.
What is the SMILES notation for 1-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]pyrazol-3-amine?
The canonical SMILES for 1-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]pyrazol-3-amine is Nc1ccn(CCCN2CCN(CC(F)(F)F)CC2)n1.
What is the InChIKey of 1-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]pyrazol-3-amine?
The InChIKey is DKVRVLDRCNGXCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3N5/c13-12(14,15)10-19-8-6-18(7-9-19)3-1-4-20-5-2-11(16)17-20/h2,5H,1,3-4,6-10H2,(H2,16,17).
What are the key properties of 1-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]pyrazol-3-amine?
1-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]pyrazol-3-amine has a molecular weight of 291.32 g/mol, XLogP of 1.04, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propyl]pyrazol-3-amine is sourced from PubChem (CID 63310519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).