C10H17N3O2S — CID 63311296
ethyl 2-[3-(3-aminopyrazol-1-yl)propylsulfanyl]acetate (PubChem CID 63311296) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is ethyl 2-[3-(3-aminopyrazol-1-yl)propylsulfanyl]acetate.
| Compound Name | ethyl 2-[3-(3-aminopyrazol-1-yl)propylsulfanyl]acetate |
|---|---|
| PubChem CID | 63311296 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | ethyl 2-[3-(3-aminopyrazol-1-yl)propylsulfanyl]acetate |
| SMILES | CCOC(=O)CSCCCn1ccc(N)n1 |
| InChI | InChI=1S/C10H17N3O2S/c1-2-15-10(14)8-16-7-3-5-13-6-4-9(11)12-13/h4,6H,2-3,5,7-8H2,1H3,(H2,11,12) |
| InChIKey | VFAGUNIVVWXIKN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|