About [3-[(tetrazolo[1,5-a]pyrazin-5-ylamino)methyl]phenyl]methanol
[3-[(tetrazolo[1,5-a]pyrazin-5-ylamino)methyl]phenyl]methanol (PubChem CID 63311511) has the molecular formula C12H12N6O
and a molecular weight of 256.27 g/mol. Its IUPAC name is [3-[(tetrazolo[1,5-a]pyrazin-5-ylamino)methyl]phenyl]methanol.
Molecular Properties
| Compound Name | [3-[(tetrazolo[1,5-a]pyrazin-5-ylamino)methyl]phenyl]methanol |
| PubChem CID | 63311511 |
| Molecular Formula | C12H12N6O |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | [3-[(tetrazolo[1,5-a]pyrazin-5-ylamino)methyl]phenyl]methanol |
| SMILES | OCc1cccc(CNc2cncc3nnnn23)c1 |
| InChI | InChI=1S/C12H12N6O/c19-8-10-3-1-2-9(4-10)5-14-11-6-13-7-12-15-16-17-18(11)12/h1-4,6-7,14,19H,5,8H2 |
| InChIKey | FCJZXEOOCGBYIP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-[(tetrazolo[1,5-a]pyrazin-5-ylamino)methyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(tetrazolo[1,5-a]pyrazin-5-ylamino)methyl]phenyl]methanol?
The IUPAC name of [3-[(tetrazolo[1,5-a]pyrazin-5-ylamino)methyl]phenyl]methanol (CID 63311511) is [3-[(tetrazolo[1,5-a]pyrazin-5-ylamino)methyl]phenyl]methanol.
What is the SMILES notation for [3-[(tetrazolo[1,5-a]pyrazin-5-ylamino)methyl]phenyl]methanol?
The canonical SMILES for [3-[(tetrazolo[1,5-a]pyrazin-5-ylamino)methyl]phenyl]methanol is OCc1cccc(CNc2cncc3nnnn23)c1.
What is the InChIKey of [3-[(tetrazolo[1,5-a]pyrazin-5-ylamino)methyl]phenyl]methanol?
The InChIKey is FCJZXEOOCGBYIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N6O/c19-8-10-3-1-2-9(4-10)5-14-11-6-13-7-12-15-16-17-18(11)12/h1-4,6-7,14,19H,5,8H2.
What are the key properties of [3-[(tetrazolo[1,5-a]pyrazin-5-ylamino)methyl]phenyl]methanol?
[3-[(tetrazolo[1,5-a]pyrazin-5-ylamino)methyl]phenyl]methanol has a molecular weight of 256.27 g/mol, XLogP of 0.62, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(tetrazolo[1,5-a]pyrazin-5-ylamino)methyl]phenyl]methanol is sourced from PubChem (CID 63311511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).