About 2-methyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)-1,3-benzoxazol-5-amine
2-methyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)-1,3-benzoxazol-5-amine (PubChem CID 63311832) has the molecular formula C16H14N4O
and a molecular weight of 278.32 g/mol. Its IUPAC name is 2-methyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)-1,3-benzoxazol-5-amine.
Molecular Properties
| Compound Name | 2-methyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)-1,3-benzoxazol-5-amine |
| PubChem CID | 63311832 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-methyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)-1,3-benzoxazol-5-amine |
| SMILES | Cc1nc2cc(NCc3cnn4ccccc34)ccc2o1 |
| InChI | InChI=1S/C16H14N4O/c1-11-19-14-8-13(5-6-16(14)21-11)17-9-12-10-18-20-7-3-2-4-15(12)20/h2-8,10,17H,9H2,1H3 |
| InChIKey | PRFQMJISOHCCGP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)-1,3-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)-1,3-benzoxazol-5-amine?
The IUPAC name of 2-methyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)-1,3-benzoxazol-5-amine (CID 63311832) is 2-methyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)-1,3-benzoxazol-5-amine.
What is the SMILES notation for 2-methyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)-1,3-benzoxazol-5-amine?
The canonical SMILES for 2-methyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)-1,3-benzoxazol-5-amine is Cc1nc2cc(NCc3cnn4ccccc34)ccc2o1.
What is the InChIKey of 2-methyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)-1,3-benzoxazol-5-amine?
The InChIKey is PRFQMJISOHCCGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O/c1-11-19-14-8-13(5-6-16(14)21-11)17-9-12-10-18-20-7-3-2-4-15(12)20/h2-8,10,17H,9H2,1H3.
What are the key properties of 2-methyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)-1,3-benzoxazol-5-amine?
2-methyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)-1,3-benzoxazol-5-amine has a molecular weight of 278.32 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)-1,3-benzoxazol-5-amine is sourced from PubChem (CID 63311832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).