C16H17N3 — CID 63312135
2-ethyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)aniline (PubChem CID 63312135) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-ethyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)aniline.
| Compound Name | 2-ethyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 63312135 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2-ethyl-N-(pyrazolo[1,5-a]pyridin-3-ylmethyl)aniline |
| SMILES | CCc1ccccc1NCc1cnn2ccccc12 |
| InChI | InChI=1S/C16H17N3/c1-2-13-7-3-4-8-15(13)17-11-14-12-18-19-10-6-5-9-16(14)19/h3-10,12,17H,2,11H2,1H3 |
| InChIKey | UKIMBQBMUWBDAZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |