About ethyl 2-(2-oxo-1,3-thiazol-3-yl)acetate
ethyl 2-(2-oxo-1,3-thiazol-3-yl)acetate (PubChem CID 63312394) has the molecular formula C7H9NO3S
and a molecular weight of 187.22 g/mol. Its IUPAC name is ethyl 2-(2-oxo-1,3-thiazol-3-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(2-oxo-1,3-thiazol-3-yl)acetate |
| PubChem CID | 63312394 |
| Molecular Formula | C7H9NO3S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | ethyl 2-(2-oxo-1,3-thiazol-3-yl)acetate |
| SMILES | CCOC(=O)Cn1ccsc1=O |
| InChI | InChI=1S/C7H9NO3S/c1-2-11-6(9)5-8-3-4-12-7(8)10/h3-4H,2,5H2,1H3 |
| InChIKey | JRENJLVLBYLYEU-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(2-oxo-1,3-thiazol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2-oxo-1,3-thiazol-3-yl)acetate?
The IUPAC name of ethyl 2-(2-oxo-1,3-thiazol-3-yl)acetate (CID 63312394) is ethyl 2-(2-oxo-1,3-thiazol-3-yl)acetate.
What is the SMILES notation for ethyl 2-(2-oxo-1,3-thiazol-3-yl)acetate?
The canonical SMILES for ethyl 2-(2-oxo-1,3-thiazol-3-yl)acetate is CCOC(=O)Cn1ccsc1=O.
What is the InChIKey of ethyl 2-(2-oxo-1,3-thiazol-3-yl)acetate?
The InChIKey is JRENJLVLBYLYEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S/c1-2-11-6(9)5-8-3-4-12-7(8)10/h3-4H,2,5H2,1H3.
What are the key properties of ethyl 2-(2-oxo-1,3-thiazol-3-yl)acetate?
ethyl 2-(2-oxo-1,3-thiazol-3-yl)acetate has a molecular weight of 187.22 g/mol, XLogP of 0.47, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2-oxo-1,3-thiazol-3-yl)acetate is sourced from PubChem (CID 63312394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).