About 3-(2-oxopropyl)-1,3-thiazol-2-one
3-(2-oxopropyl)-1,3-thiazol-2-one (PubChem CID 63312407) has the molecular formula C6H7NO2S
and a molecular weight of 157.19 g/mol. Its IUPAC name is 3-(2-oxopropyl)-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-(2-oxopropyl)-1,3-thiazol-2-one |
| PubChem CID | 63312407 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | 3-(2-oxopropyl)-1,3-thiazol-2-one |
| SMILES | CC(=O)Cn1ccsc1=O |
| InChI | InChI=1S/C6H7NO2S/c1-5(8)4-7-2-3-10-6(7)9/h2-3H,4H2,1H3 |
| InChIKey | UCQQFGYULBFIJR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-oxopropyl)-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-oxopropyl)-1,3-thiazol-2-one?
The IUPAC name of 3-(2-oxopropyl)-1,3-thiazol-2-one (CID 63312407) is 3-(2-oxopropyl)-1,3-thiazol-2-one.
What is the SMILES notation for 3-(2-oxopropyl)-1,3-thiazol-2-one?
The canonical SMILES for 3-(2-oxopropyl)-1,3-thiazol-2-one is CC(=O)Cn1ccsc1=O.
What is the InChIKey of 3-(2-oxopropyl)-1,3-thiazol-2-one?
The InChIKey is UCQQFGYULBFIJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S/c1-5(8)4-7-2-3-10-6(7)9/h2-3H,4H2,1H3.
What are the key properties of 3-(2-oxopropyl)-1,3-thiazol-2-one?
3-(2-oxopropyl)-1,3-thiazol-2-one has a molecular weight of 157.19 g/mol, XLogP of 0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-oxopropyl)-1,3-thiazol-2-one is sourced from PubChem (CID 63312407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).