About 3-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-1,3-thiazol-2-one
3-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-1,3-thiazol-2-one (PubChem CID 63312448) has the molecular formula C10H15N3O2S
and a molecular weight of 241.32 g/mol. Its IUPAC name is 3-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-1,3-thiazol-2-one |
| PubChem CID | 63312448 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-1,3-thiazol-2-one |
| SMILES | O=C(Cn1ccsc1=O)N1CCCNCC1 |
| InChI | InChI=1S/C10H15N3O2S/c14-9(8-13-6-7-16-10(13)15)12-4-1-2-11-3-5-12/h6-7,11H,1-5,8H2 |
| InChIKey | ILMXJTOFYZAKLQ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-1,3-thiazol-2-one?
The IUPAC name of 3-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-1,3-thiazol-2-one (CID 63312448) is 3-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-1,3-thiazol-2-one.
What is the SMILES notation for 3-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-1,3-thiazol-2-one?
The canonical SMILES for 3-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-1,3-thiazol-2-one is O=C(Cn1ccsc1=O)N1CCCNCC1.
What is the InChIKey of 3-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-1,3-thiazol-2-one?
The InChIKey is ILMXJTOFYZAKLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2S/c14-9(8-13-6-7-16-10(13)15)12-4-1-2-11-3-5-12/h6-7,11H,1-5,8H2.
What are the key properties of 3-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-1,3-thiazol-2-one?
3-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-1,3-thiazol-2-one has a molecular weight of 241.32 g/mol, XLogP of -0.27, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-1,3-thiazol-2-one is sourced from PubChem (CID 63312448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).