C11H21N3O — CID 63312681
3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]butanenitrile (PubChem CID 63312681) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]butanenitrile.
| Compound Name | 3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]butanenitrile |
|---|---|
| PubChem CID | 63312681 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]butanenitrile |
| SMILES | CC(CC#N)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C11H21N3O/c1-11(3-4-12)14-6-2-5-13(7-8-14)9-10-15/h11,15H,2-3,5-10H2,1H3 |
| InChIKey | CFOVYWDDJIVUAX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |