About butyl 2-(2-oxo-1,3-thiazol-3-yl)acetate
butyl 2-(2-oxo-1,3-thiazol-3-yl)acetate (PubChem CID 63312789) has the molecular formula C9H13NO3S
and a molecular weight of 215.27 g/mol. Its IUPAC name is butyl 2-(2-oxo-1,3-thiazol-3-yl)acetate.
Molecular Properties
| Compound Name | butyl 2-(2-oxo-1,3-thiazol-3-yl)acetate |
| PubChem CID | 63312789 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | butyl 2-(2-oxo-1,3-thiazol-3-yl)acetate |
| SMILES | CCCCOC(=O)Cn1ccsc1=O |
| InChI | InChI=1S/C9H13NO3S/c1-2-3-5-13-8(11)7-10-4-6-14-9(10)12/h4,6H,2-3,5,7H2,1H3 |
| InChIKey | INQIVOPKISPABU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-(2-oxo-1,3-thiazol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-(2-oxo-1,3-thiazol-3-yl)acetate?
The IUPAC name of butyl 2-(2-oxo-1,3-thiazol-3-yl)acetate (CID 63312789) is butyl 2-(2-oxo-1,3-thiazol-3-yl)acetate.
What is the SMILES notation for butyl 2-(2-oxo-1,3-thiazol-3-yl)acetate?
The canonical SMILES for butyl 2-(2-oxo-1,3-thiazol-3-yl)acetate is CCCCOC(=O)Cn1ccsc1=O.
What is the InChIKey of butyl 2-(2-oxo-1,3-thiazol-3-yl)acetate?
The InChIKey is INQIVOPKISPABU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3S/c1-2-3-5-13-8(11)7-10-4-6-14-9(10)12/h4,6H,2-3,5,7H2,1H3.
What are the key properties of butyl 2-(2-oxo-1,3-thiazol-3-yl)acetate?
butyl 2-(2-oxo-1,3-thiazol-3-yl)acetate has a molecular weight of 215.27 g/mol, XLogP of 1.25, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-(2-oxo-1,3-thiazol-3-yl)acetate is sourced from PubChem (CID 63312789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).