About 3-(3-chloropropyl)-1,3-thiazol-2-one
3-(3-chloropropyl)-1,3-thiazol-2-one (PubChem CID 63312790) has the molecular formula C6H8ClNOS
and a molecular weight of 177.66 g/mol. Its IUPAC name is 3-(3-chloropropyl)-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-(3-chloropropyl)-1,3-thiazol-2-one |
| PubChem CID | 63312790 |
| Molecular Formula | C6H8ClNOS |
| Molecular Weight | 177.66 g/mol |
| Exact Mass | 177.00 |
| IUPAC Name | 3-(3-chloropropyl)-1,3-thiazol-2-one |
| SMILES | O=c1sccn1CCCCl |
| InChI | InChI=1S/C6H8ClNOS/c7-2-1-3-8-4-5-10-6(8)9/h4-5H,1-3H2 |
| InChIKey | HWOFUFPATQSTPF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.66 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-chloropropyl)-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chloropropyl)-1,3-thiazol-2-one?
The IUPAC name of 3-(3-chloropropyl)-1,3-thiazol-2-one (CID 63312790) is 3-(3-chloropropyl)-1,3-thiazol-2-one.
What is the SMILES notation for 3-(3-chloropropyl)-1,3-thiazol-2-one?
The canonical SMILES for 3-(3-chloropropyl)-1,3-thiazol-2-one is O=c1sccn1CCCCl.
What is the InChIKey of 3-(3-chloropropyl)-1,3-thiazol-2-one?
The InChIKey is HWOFUFPATQSTPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClNOS/c7-2-1-3-8-4-5-10-6(8)9/h4-5H,1-3H2.
What are the key properties of 3-(3-chloropropyl)-1,3-thiazol-2-one?
3-(3-chloropropyl)-1,3-thiazol-2-one has a molecular weight of 177.66 g/mol, XLogP of 1.54, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloropropyl)-1,3-thiazol-2-one is sourced from PubChem (CID 63312790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).