About 3-(3-amino-2-hydroxypropyl)-4,5-dimethyl-1,3-thiazol-2-one
3-(3-amino-2-hydroxypropyl)-4,5-dimethyl-1,3-thiazol-2-one (PubChem CID 63312952) has the molecular formula C8H14N2O2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 3-(3-amino-2-hydroxypropyl)-4,5-dimethyl-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-(3-amino-2-hydroxypropyl)-4,5-dimethyl-1,3-thiazol-2-one |
| PubChem CID | 63312952 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 3-(3-amino-2-hydroxypropyl)-4,5-dimethyl-1,3-thiazol-2-one |
| SMILES | Cc1sc(=O)n(CC(O)CN)c1C |
| InChI | InChI=1S/C8H14N2O2S/c1-5-6(2)13-8(12)10(5)4-7(11)3-9/h7,11H,3-4,9H2,1-2H3 |
| InChIKey | MCGIMGYFTPESGB-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-amino-2-hydroxypropyl)-4,5-dimethyl-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-2-hydroxypropyl)-4,5-dimethyl-1,3-thiazol-2-one?
The IUPAC name of 3-(3-amino-2-hydroxypropyl)-4,5-dimethyl-1,3-thiazol-2-one (CID 63312952) is 3-(3-amino-2-hydroxypropyl)-4,5-dimethyl-1,3-thiazol-2-one.
What is the SMILES notation for 3-(3-amino-2-hydroxypropyl)-4,5-dimethyl-1,3-thiazol-2-one?
The canonical SMILES for 3-(3-amino-2-hydroxypropyl)-4,5-dimethyl-1,3-thiazol-2-one is Cc1sc(=O)n(CC(O)CN)c1C.
What is the InChIKey of 3-(3-amino-2-hydroxypropyl)-4,5-dimethyl-1,3-thiazol-2-one?
The InChIKey is MCGIMGYFTPESGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2S/c1-5-6(2)13-8(12)10(5)4-7(11)3-9/h7,11H,3-4,9H2,1-2H3.
What are the key properties of 3-(3-amino-2-hydroxypropyl)-4,5-dimethyl-1,3-thiazol-2-one?
3-(3-amino-2-hydroxypropyl)-4,5-dimethyl-1,3-thiazol-2-one has a molecular weight of 202.28 g/mol, XLogP of -0.15, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-2-hydroxypropyl)-4,5-dimethyl-1,3-thiazol-2-one is sourced from PubChem (CID 63312952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).