C8H13F3N4OS — CID 63312974
[4-methyl-5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine (PubChem CID 63312974) has the molecular formula C8H13F3N4OS and a molecular weight of 270.28 g/mol. Its IUPAC name is [4-methyl-5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [4-methyl-5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 63312974 |
| Molecular Formula | C8H13F3N4OS |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | [4-methyl-5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine |
| SMILES | Cn1c(CN)nnc1SCCOCC(F)(F)F |
| InChI | InChI=1S/C8H13F3N4OS/c1-15-6(4-12)13-14-7(15)17-3-2-16-5-8(9,10)11/h2-5,12H2,1H3 |
| InChIKey | FWTSAVKIHNHWRW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|