C12H22N6O2S — CID 63313784
N-(2-acetamidoethyl)-2-[[5-(aminomethyl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 63313784) has the molecular formula C12H22N6O2S and a molecular weight of 314.42 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-[[5-(aminomethyl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-[[5-(aminomethyl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 63313784 |
| Molecular Formula | C12H22N6O2S |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-(2-acetamidoethyl)-2-[[5-(aminomethyl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCCn1c(CN)nnc1SCC(=O)NCCNC(C)=O |
| InChI | InChI=1S/C12H22N6O2S/c1-3-6-18-10(7-13)16-17-12(18)21-8-11(20)15-5-4-14-9(2)19/h3-8,13H2,1-2H3,(H,14,19)(H,15,20) |
| InChIKey | JHYXMBYIWJAWQY-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|