C11H19F3N4OS — CID 63314024
[4-propyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-yl]methanamine (PubChem CID 63314024) has the molecular formula C11H19F3N4OS and a molecular weight of 312.36 g/mol. Its IUPAC name is [4-propyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [4-propyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 63314024 |
| Molecular Formula | C11H19F3N4OS |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [4-propyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-yl]methanamine |
| SMILES | CCCn1c(CN)nnc1SCCCOCC(F)(F)F |
| InChI | InChI=1S/C11H19F3N4OS/c1-2-4-18-9(7-15)16-17-10(18)20-6-3-5-19-8-11(12,13)14/h2-8,15H2,1H3 |
| InChIKey | LULRXIKZTXGZMN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|