C11H19N9S — CID 63314122
6-[[5-(aminomethyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 63314122) has the molecular formula C11H19N9S and a molecular weight of 309.40 g/mol. Its IUPAC name is 6-[[5-(aminomethyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[5-(aminomethyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 63314122 |
| Molecular Formula | C11H19N9S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 6-[[5-(aminomethyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCn1c(CN)nnc1SCc1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H19N9S/c1-4-20-8(5-12)17-18-11(20)21-6-7-14-9(13)16-10(15-7)19(2)3/h4-6,12H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | SYXMIHWJHXDQCY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |