C26H45NNaO5S — CID 6331437
Taurolithocholic acid sodium salt (PubChem CID 6331437) has the molecular formula C26H45NNaO5S and a molecular weight of 506.71 g/mol.
| Compound Name | Taurolithocholic acid sodium salt |
|---|---|
| PubChem CID | 6331437 |
| Molecular Formula | C26H45NNaO5S |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | — |
| SMILES | C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C.[Na] |
| InChI | InChI=1S/C26H45NO5S.Na/c1-17(4-9-24(29)27-14-15-33(30,31)32)21-7-8-22-20-6-5-18-16-19(28)10-12-25(18,2)23(20)11-13-26(21,22)3;/h17-23,28H,4-16H2,1-3H3,(H,27,29)(H,30,31,32);/t17-,18-,19-,20+,21-,22+,23+,25+,26-;/m1./s1 |
| InChIKey | YWXCPBUMOMIAJB-HRHHVWJRSA-N |
| XLogP | 4.05 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|