C18H25N3 — CID 63314495
N'-cyclopentyl-N'-methyl-N-(quinolin-8-ylmethyl)ethane-1,2-diamine (PubChem CID 63314495) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is N'-cyclopentyl-N'-methyl-N-(quinolin-8-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-cyclopentyl-N'-methyl-N-(quinolin-8-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 63314495 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | N'-cyclopentyl-N'-methyl-N-(quinolin-8-ylmethyl)ethane-1,2-diamine |
| SMILES | CN(CCNCc1cccc2cccnc12)C1CCCC1 |
| InChI | InChI=1S/C18H25N3/c1-21(17-9-2-3-10-17)13-12-19-14-16-7-4-6-15-8-5-11-20-18(15)16/h4-8,11,17,19H,2-3,9-10,12-14H2,1H3 |
| InChIKey | GNQGPCJNWSGALR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|