About N'-cyclopentyl-N'-methyl-N-(3-phenylcyclobutyl)ethane-1,2-diamine
N'-cyclopentyl-N'-methyl-N-(3-phenylcyclobutyl)ethane-1,2-diamine (PubChem CID 63314496) has the molecular formula C18H28N2
and a molecular weight of 272.44 g/mol. Its IUPAC name is N'-cyclopentyl-N'-methyl-N-(3-phenylcyclobutyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-cyclopentyl-N'-methyl-N-(3-phenylcyclobutyl)ethane-1,2-diamine |
| PubChem CID | 63314496 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N'-cyclopentyl-N'-methyl-N-(3-phenylcyclobutyl)ethane-1,2-diamine |
| SMILES | CN(CCNC1CC(c2ccccc2)C1)C1CCCC1 |
| InChI | InChI=1S/C18H28N2/c1-20(18-9-5-6-10-18)12-11-19-17-13-16(14-17)15-7-3-2-4-8-15/h2-4,7-8,16-19H,5-6,9-14H2,1H3 |
| InChIKey | NAMHHVOCKLMBGU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-cyclopentyl-N'-methyl-N-(3-phenylcyclobutyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopentyl-N'-methyl-N-(3-phenylcyclobutyl)ethane-1,2-diamine?
The IUPAC name of N'-cyclopentyl-N'-methyl-N-(3-phenylcyclobutyl)ethane-1,2-diamine (CID 63314496) is N'-cyclopentyl-N'-methyl-N-(3-phenylcyclobutyl)ethane-1,2-diamine.
What is the SMILES notation for N'-cyclopentyl-N'-methyl-N-(3-phenylcyclobutyl)ethane-1,2-diamine?
The canonical SMILES for N'-cyclopentyl-N'-methyl-N-(3-phenylcyclobutyl)ethane-1,2-diamine is CN(CCNC1CC(c2ccccc2)C1)C1CCCC1.
What is the InChIKey of N'-cyclopentyl-N'-methyl-N-(3-phenylcyclobutyl)ethane-1,2-diamine?
The InChIKey is NAMHHVOCKLMBGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2/c1-20(18-9-5-6-10-18)12-11-19-17-13-16(14-17)15-7-3-2-4-8-15/h2-4,7-8,16-19H,5-6,9-14H2,1H3.
What are the key properties of N'-cyclopentyl-N'-methyl-N-(3-phenylcyclobutyl)ethane-1,2-diamine?
N'-cyclopentyl-N'-methyl-N-(3-phenylcyclobutyl)ethane-1,2-diamine has a molecular weight of 272.44 g/mol, XLogP of 3.40, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopentyl-N'-methyl-N-(3-phenylcyclobutyl)ethane-1,2-diamine is sourced from PubChem (CID 63314496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).