C11H17F3N4OS — CID 63314609
[4-cyclopropyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-yl]methanamine (PubChem CID 63314609) has the molecular formula C11H17F3N4OS and a molecular weight of 310.35 g/mol. Its IUPAC name is [4-cyclopropyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [4-cyclopropyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 63314609 |
| Molecular Formula | C11H17F3N4OS |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [4-cyclopropyl-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-yl]methanamine |
| SMILES | NCc1nnc(SCCCOCC(F)(F)F)n1C1CC1 |
| InChI | InChI=1S/C11H17F3N4OS/c12-11(13,14)7-19-4-1-5-20-10-17-16-9(6-15)18(10)8-2-3-8/h8H,1-7,15H2 |
| InChIKey | BLZMJZCGWCBVNY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|