C12H14Cl2N4OS — CID 63315151
[5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanamine (PubChem CID 63315151) has the molecular formula C12H14Cl2N4OS and a molecular weight of 333.24 g/mol. Its IUPAC name is [5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 63315151 |
| Molecular Formula | C12H14Cl2N4OS |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | [5-[2-(2,6-dichlorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanamine |
| SMILES | Cn1c(CN)nnc1SCCOc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H14Cl2N4OS/c1-18-10(7-15)16-17-12(18)20-6-5-19-11-8(13)3-2-4-9(11)14/h2-4H,5-7,15H2,1H3 |
| InChIKey | ZJMOVRQUVONBBW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|