C11H11N2O6PS2 — CID 6331585
[5-hydroxy-6-methyl-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-3-pyridinyl]methyl dihydrogen phosphate (PubChem CID 6331585) has the molecular formula C11H11N2O6PS2 and a molecular weight of 362.33 g/mol. Its IUPAC name is [5-hydroxy-6-methyl-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-3-pyridinyl]methyl dihydrogen phosphate.
| Compound Name | [5-hydroxy-6-methyl-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-3-pyridinyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 6331585 |
| Molecular Formula | C11H11N2O6PS2 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | [5-hydroxy-6-methyl-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-3-pyridinyl]methyl dihydrogen phosphate |
| SMILES | Cc1ncc(COP(=O)(O)O)c(/C=C2/SC(=S)NC2=O)c1O |
| InChI | InChI=1S/C11H11N2O6PS2/c1-5-9(14)7(2-8-10(15)13-11(21)22-8)6(3-12-5)4-19-20(16,17)18/h2-3,14H,4H2,1H3,(H,13,15,21)(H2,16,17,18)/b8-2+ |
| InChIKey | WJDPAGLWZIPYMX-KRXBUXKQSA-N |
| XLogP | 1.19 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|