C14H21N3O3S — CID 63315961
2-[1-[2-[cyclopentyl(methyl)amino]ethyl]-4-oxopyrimidin-2-yl]sulfanylacetic acid (PubChem CID 63315961) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-[1-[2-[cyclopentyl(methyl)amino]ethyl]-4-oxopyrimidin-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-[2-[cyclopentyl(methyl)amino]ethyl]-4-oxopyrimidin-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 63315961 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-[1-[2-[cyclopentyl(methyl)amino]ethyl]-4-oxopyrimidin-2-yl]sulfanylacetic acid |
| SMILES | CN(CCn1ccc(=O)nc1SCC(=O)O)C1CCCC1 |
| InChI | InChI=1S/C14H21N3O3S/c1-16(11-4-2-3-5-11)8-9-17-7-6-12(18)15-14(17)21-10-13(19)20/h6-7,11H,2-5,8-10H2,1H3,(H,19,20) |
| InChIKey | JADMHLQBXJIHSV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |