C65H80N2NaO14 — CID 6331597
CID 6331597 (PubChem CID 6331597) has the molecular formula C65H80N2NaO14 and a molecular weight of 1136.34 g/mol.
| Compound Name | CID 6331597 |
|---|---|
| PubChem CID | 6331597 |
| Molecular Formula | C65H80N2NaO14 |
| Molecular Weight | 1136.34 g/mol |
| Exact Mass | 1135.55 |
| IUPAC Name | — |
| SMILES | COc1ccc(C(=O)Nc2cc(C(=CCC[C@H]3CC[C@@]4(C)[C@@H](CC[C@@H]5[C@@H]4CC[C@]4(C)[C@@H](C(C)CCCC(C)C)CC[C@@H]54)C3)c3cc(NC(=O)c4ccc(OC)c(C(=O)O)c4)c(OC)c(C(=O)O)c3)cc(C(=O)O)c2OC)cc1C(=O)O.[Na] |
| InChI | InChI=1S/C65H80N2O14.Na/c1-35(2)12-10-13-36(3)49-20-21-50-44-19-18-42-28-37(24-26-64(42,4)51(44)25-27-65(49,50)5)14-11-15-43(40-31-47(62(74)75)56(80-8)52(33-40)66-58(68)38-16-22-54(78-6)45(29-38)60(70)71)41-32-48(63(76)77)57(81-9)53(34-41)67-59(69)39-17-23-55(79-7)46(30-39)61(72)73;/h15-17,22-23,29-37,42,44,49-51H,10-14,18-21,24-28H2,1-9H3,(H,66,68)(H,67,69)(H,70,71)(H,72,73)(H,74,75)(H,76,77);/t36?,37-,42-,44-,49+,50-,51-,64-,65+;/m0./s1 |
| InChIKey | AMPJULYHTNNVIK-CXFZRNCRSA-N |
| XLogP | 13.59 |
| TPSA | 244.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1136.34 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |