C15H16FNO4 — CID 63316923
5-[[1-(5-fluoro-2-methoxyphenyl)ethylamino]methyl]furan-2-carboxylic acid (PubChem CID 63316923) has the molecular formula C15H16FNO4 and a molecular weight of 293.29 g/mol. Its IUPAC name is 5-[[1-(5-fluoro-2-methoxyphenyl)ethylamino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[1-(5-fluoro-2-methoxyphenyl)ethylamino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 63316923 |
| Molecular Formula | C15H16FNO4 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 5-[[1-(5-fluoro-2-methoxyphenyl)ethylamino]methyl]furan-2-carboxylic acid |
| SMILES | COc1ccc(F)cc1C(C)NCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C15H16FNO4/c1-9(12-7-10(16)3-5-13(12)20-2)17-8-11-4-6-14(21-11)15(18)19/h3-7,9,17H,8H2,1-2H3,(H,18,19) |
| InChIKey | WIBBECUMYTZMNI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |