C15H20FN5 — CID 63318148
1-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]pyrazol-3-amine (PubChem CID 63318148) has the molecular formula C15H20FN5 and a molecular weight of 289.36 g/mol. Its IUPAC name is 1-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]pyrazol-3-amine.
| Compound Name | 1-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 63318148 |
| Molecular Formula | C15H20FN5 |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 1-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]pyrazol-3-amine |
| SMILES | Nc1ccn(CCN2CCN(c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C15H20FN5/c16-13-1-3-14(4-2-13)20-10-7-19(8-11-20)9-12-21-6-5-15(17)18-21/h1-6H,7-12H2,(H2,17,18) |
| InChIKey | IUJQCJDVMBAIRV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |