C11H20N4 — CID 63318334
1-[2-(2-ethylpyrrolidin-1-yl)ethyl]pyrazol-3-amine (PubChem CID 63318334) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-[2-(2-ethylpyrrolidin-1-yl)ethyl]pyrazol-3-amine.
| Compound Name | 1-[2-(2-ethylpyrrolidin-1-yl)ethyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 63318334 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 1-[2-(2-ethylpyrrolidin-1-yl)ethyl]pyrazol-3-amine |
| SMILES | CCC1CCCN1CCn1ccc(N)n1 |
| InChI | InChI=1S/C11H20N4/c1-2-10-4-3-6-14(10)8-9-15-7-5-11(12)13-15/h5,7,10H,2-4,6,8-9H2,1H3,(H2,12,13) |
| InChIKey | HKKWXYGIGCMAJS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |